Dalaniz12 Dalaniz12

07-10-2016
Mathematics

contestada

the expression 5x-4 and 3x represents two sides in meters of a regular octagon find the perimeter of the octagon

Respuesta :

Аноним Аноним

07-10-2016

I hope this helps you 5x-4=3x 5x-3x=4 2x=4 x=2 8.3x=8.3.2=48

Answer Link

Otras preguntas

What is the area of the triangle rounded to nearest hundredth

Solve each quadratic equation by factoring. 1] x^2+24=11x 2] 2x^2+12x-14=0

Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct

Need help with history

You describe Alicia’s eyes like the color of the sky. In Spanish you would say _____.

Mia throws a softball from a star and a height of 10 feet, with an initial velocity of 12 ft./s. Which of the following question show the path of the snowball?

which kingdoms are all organisms multicellular

Let f(x)=e^x and g(x)=x+6. what are the domain and range of (g*f)(x)?

what is the theoretical yield of copper produced by this reaction Al with CuCl2 Al - 0.5g CuCl2 - 3.5g

how do i say we used to do homework and school work with no technology now we use computers to do all of it. in spanish